C8H15ClN2O3 — CID 54384258
chloromethyl N-(1-amino-4-methyl-1-oxopentan-2-yl)carbamate (PubChem CID 54384258) has the molecular formula C8H15ClN2O3 and a molecular weight of 222.67 g/mol. Its IUPAC name is chloromethyl N-(1-amino-4-methyl-1-oxopentan-2-yl)carbamate.
| Compound Name | chloromethyl N-(1-amino-4-methyl-1-oxopentan-2-yl)carbamate |
|---|---|
| PubChem CID | 54384258 |
| Molecular Formula | C8H15ClN2O3 |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | chloromethyl N-(1-amino-4-methyl-1-oxopentan-2-yl)carbamate |
| SMILES | CC(C)CC(NC(=O)OCCl)C(N)=O |
| InChI | InChI=1S/C8H15ClN2O3/c1-5(2)3-6(7(10)12)11-8(13)14-4-9/h5-6H,3-4H2,1-2H3,(H2,10,12)(H,11,13) |
| InChIKey | PUOIWYRHCJWVJY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|