C9H17NO4 — CID 14036587
methyl (2S)-2-(methoxycarbonylamino)-4-methylpentanoate (PubChem CID 14036587) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is methyl (2S)-2-(methoxycarbonylamino)-4-methylpentanoate.
| Compound Name | methyl (2S)-2-(methoxycarbonylamino)-4-methylpentanoate |
|---|---|
| PubChem CID | 14036587 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | methyl (2S)-2-(methoxycarbonylamino)-4-methylpentanoate |
| SMILES | COC(=O)N[C@@H](CC(C)C)C(=O)OC |
| InChI | InChI=1S/C9H17NO4/c1-6(2)5-7(8(11)13-3)10-9(12)14-4/h6-7H,5H2,1-4H3,(H,10,12)/t7-/m0/s1 |
| InChIKey | PRTMBLSLGXIFOD-ZETCQYMHSA-N |
| XLogP | 0.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |