C9H18N2O4 — CID 47407232
methyl N-[1-(methoxyamino)-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 47407232) has the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. Its IUPAC name is methyl N-[1-(methoxyamino)-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | methyl N-[1-(methoxyamino)-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 47407232 |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | methyl N-[1-(methoxyamino)-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CONC(=O)C(CC(C)C)NC(=O)OC |
| InChI | InChI=1S/C9H18N2O4/c1-6(2)5-7(8(12)11-15-4)10-9(13)14-3/h6-7H,5H2,1-4H3,(H,10,13)(H,11,12) |
| InChIKey | JBUKDHUAAYVANJ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|