methyl N-[(4R)-2,2,6-trimethyl-3-oxoheptan-4-yl]carbamate

C12H23NO3 — CID 59450088

IUPACmethyl N-[(4R)-2,2,6-trimethyl-3-oxoheptan-4-yl]carbamate
SMILESCOC(=O)N[C@H](CC(C)C)C(=O)C(C)(C)C
InChIInChI=1S/C12H23NO3/c1-8(2)7-9(13-11(15)16-6)10(14)12(3,4)5/h8-9H,7H2,1-6H3,(H,13,15)/t9-/m1/s1
InChIKeyVTTRWDBGOXTRNM-SECBINFHSA-N
MW229.32 g/mol
LogP2.37
Rot. Bonds4

About methyl N-[(4R)-2,2,6-trimethyl-3-oxoheptan-4-yl]carbamate

methyl N-[(4R)-2,2,6-trimethyl-3-oxoheptan-4-yl]carbamate (PubChem CID 59450088) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is methyl N-[(4R)-2,2,6-trimethyl-3-oxoheptan-4-yl]carbamate.

Molecular Properties

Compound Namemethyl N-[(4R)-2,2,6-trimethyl-3-oxoheptan-4-yl]carbamate
PubChem CID59450088
Molecular FormulaC12H23NO3
Molecular Weight229.32 g/mol
Exact Mass229.17
IUPAC Namemethyl N-[(4R)-2,2,6-trimethyl-3-oxoheptan-4-yl]carbamate
SMILESCOC(=O)N[C@H](CC(C)C)C(=O)C(C)(C)C
InChIInChI=1S/C12H23NO3/c1-8(2)7-9(13-11(15)16-6)10(14)12(3,4)5/h8-9H,7H2,1-6H3,(H,13,15)/t9-/m1/s1
InChIKeyVTTRWDBGOXTRNM-SECBINFHSA-N
XLogP2.37
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.32
LogP ≤ 52.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl N-[(4R)-2,2,6-trimethyl-3-oxoheptan-4-yl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-[(4R)-2,2,6-trimethyl-3-oxoheptan-4-yl]carbamate?
The IUPAC name of methyl N-[(4R)-2,2,6-trimethyl-3-oxoheptan-4-yl]carbamate (CID 59450088) is methyl N-[(4R)-2,2,6-trimethyl-3-oxoheptan-4-yl]carbamate.
What is the SMILES notation for methyl N-[(4R)-2,2,6-trimethyl-3-oxoheptan-4-yl]carbamate?
The canonical SMILES for methyl N-[(4R)-2,2,6-trimethyl-3-oxoheptan-4-yl]carbamate is COC(=O)N[C@H](CC(C)C)C(=O)C(C)(C)C.
What is the InChIKey of methyl N-[(4R)-2,2,6-trimethyl-3-oxoheptan-4-yl]carbamate?
The InChIKey is VTTRWDBGOXTRNM-SECBINFHSA-N. The full InChI is InChI=1S/C12H23NO3/c1-8(2)7-9(13-11(15)16-6)10(14)12(3,4)5/h8-9H,7H2,1-6H3,(H,13,15)/t9-/m1/s1.
What are the key properties of methyl N-[(4R)-2,2,6-trimethyl-3-oxoheptan-4-yl]carbamate?
methyl N-[(4R)-2,2,6-trimethyl-3-oxoheptan-4-yl]carbamate has a molecular weight of 229.32 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(4R)-2,2,6-trimethyl-3-oxoheptan-4-yl]carbamate is sourced from PubChem (CID 59450088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).