C12H23NO3 — CID 59450088
methyl N-[(4R)-2,2,6-trimethyl-3-oxoheptan-4-yl]carbamate (PubChem CID 59450088) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is methyl N-[(4R)-2,2,6-trimethyl-3-oxoheptan-4-yl]carbamate.
| Compound Name | methyl N-[(4R)-2,2,6-trimethyl-3-oxoheptan-4-yl]carbamate |
|---|---|
| PubChem CID | 59450088 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | methyl N-[(4R)-2,2,6-trimethyl-3-oxoheptan-4-yl]carbamate |
| SMILES | COC(=O)N[C@H](CC(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C12H23NO3/c1-8(2)7-9(13-11(15)16-6)10(14)12(3,4)5/h8-9H,7H2,1-6H3,(H,13,15)/t9-/m1/s1 |
| InChIKey | VTTRWDBGOXTRNM-SECBINFHSA-N |
| XLogP | 2.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |