C12H23NO3 — CID 162785228
2-hydroxy-N-[(4S)-2,2,6-trimethyl-3-oxoheptan-4-yl]acetamide (PubChem CID 162785228) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is 2-hydroxy-N-[(4S)-2,2,6-trimethyl-3-oxoheptan-4-yl]acetamide.
| Compound Name | 2-hydroxy-N-[(4S)-2,2,6-trimethyl-3-oxoheptan-4-yl]acetamide |
|---|---|
| PubChem CID | 162785228 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 2-hydroxy-N-[(4S)-2,2,6-trimethyl-3-oxoheptan-4-yl]acetamide |
| SMILES | CC(C)C[C@H](NC(=O)CO)C(=O)C(C)(C)C |
| InChI | InChI=1S/C12H23NO3/c1-8(2)6-9(13-10(15)7-14)11(16)12(3,4)5/h8-9,14H,6-7H2,1-5H3,(H,13,15)/t9-/m0/s1 |
| InChIKey | QYZRVFMYMUSFMY-VIFPVBQESA-N |
| XLogP | 1.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |