About 2-hydroxy-N-[(4S)-2,2,6-trimethyl-3-oxoheptan-4-yl]acetamide
2-hydroxy-N-[(4S)-2,2,6-trimethyl-3-oxoheptan-4-yl]acetamide (PubChem CID 162785228) has the molecular formula C12H23NO3
and a molecular weight of 229.32 g/mol. Its IUPAC name is 2-hydroxy-N-[(4S)-2,2,6-trimethyl-3-oxoheptan-4-yl]acetamide.
Molecular Properties
| Compound Name | 2-hydroxy-N-[(4S)-2,2,6-trimethyl-3-oxoheptan-4-yl]acetamide |
| PubChem CID | 162785228 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 2-hydroxy-N-[(4S)-2,2,6-trimethyl-3-oxoheptan-4-yl]acetamide |
| SMILES | CC(C)C[C@H](NC(=O)CO)C(=O)C(C)(C)C |
| InChI | InChI=1S/C12H23NO3/c1-8(2)6-9(13-10(15)7-14)11(16)12(3,4)5/h8-9,14H,6-7H2,1-5H3,(H,13,15)/t9-/m0/s1 |
| InChIKey | QYZRVFMYMUSFMY-VIFPVBQESA-N |
| XLogP | 1.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-N-[(4S)-2,2,6-trimethyl-3-oxoheptan-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N-[(4S)-2,2,6-trimethyl-3-oxoheptan-4-yl]acetamide?
The IUPAC name of 2-hydroxy-N-[(4S)-2,2,6-trimethyl-3-oxoheptan-4-yl]acetamide (CID 162785228) is 2-hydroxy-N-[(4S)-2,2,6-trimethyl-3-oxoheptan-4-yl]acetamide.
What is the SMILES notation for 2-hydroxy-N-[(4S)-2,2,6-trimethyl-3-oxoheptan-4-yl]acetamide?
The canonical SMILES for 2-hydroxy-N-[(4S)-2,2,6-trimethyl-3-oxoheptan-4-yl]acetamide is CC(C)C[C@H](NC(=O)CO)C(=O)C(C)(C)C.
What is the InChIKey of 2-hydroxy-N-[(4S)-2,2,6-trimethyl-3-oxoheptan-4-yl]acetamide?
The InChIKey is QYZRVFMYMUSFMY-VIFPVBQESA-N. The full InChI is InChI=1S/C12H23NO3/c1-8(2)6-9(13-10(15)7-14)11(16)12(3,4)5/h8-9,14H,6-7H2,1-5H3,(H,13,15)/t9-/m0/s1.
What are the key properties of 2-hydroxy-N-[(4S)-2,2,6-trimethyl-3-oxoheptan-4-yl]acetamide?
2-hydroxy-N-[(4S)-2,2,6-trimethyl-3-oxoheptan-4-yl]acetamide has a molecular weight of 229.32 g/mol, XLogP of 1.12, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N-[(4S)-2,2,6-trimethyl-3-oxoheptan-4-yl]acetamide is sourced from PubChem (CID 162785228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).