C15H32N2O2 — CID 143544198
2,4-dimethylpentanamide;N,2,4-trimethylpentanamide (PubChem CID 143544198) has the molecular formula C15H32N2O2 and a molecular weight of 272.43 g/mol. Its IUPAC name is 2,4-dimethylpentanamide;N,2,4-trimethylpentanamide.
| Compound Name | 2,4-dimethylpentanamide;N,2,4-trimethylpentanamide |
|---|---|
| PubChem CID | 143544198 |
| Molecular Formula | C15H32N2O2 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | 2,4-dimethylpentanamide;N,2,4-trimethylpentanamide |
| SMILES | CC(C)CC(C)C(N)=O.CNC(=O)C(C)CC(C)C |
| InChI | InChI=1S/C8H17NO.C7H15NO/c1-6(2)5-7(3)8(10)9-4;1-5(2)4-6(3)7(8)9/h6-7H,5H2,1-4H3,(H,9,10);5-6H,4H2,1-3H3,(H2,8,9) |
| InChIKey | JOESIVCAORKTHF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |