C8H17NO2 — CID 157214325
5-hydroxy-N,2,4-trimethylpentanamide (PubChem CID 157214325) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is 5-hydroxy-N,2,4-trimethylpentanamide.
| Compound Name | 5-hydroxy-N,2,4-trimethylpentanamide |
|---|---|
| PubChem CID | 157214325 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 5-hydroxy-N,2,4-trimethylpentanamide |
| SMILES | CNC(=O)C(C)CC(C)CO |
| InChI | InChI=1S/C8H17NO2/c1-6(5-10)4-7(2)8(11)9-3/h6-7,10H,4-5H2,1-3H3,(H,9,11) |
| InChIKey | ASFYWTRNMBAKLC-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |