About 5-hydroxy-N,2,4-trimethylpentanamide
5-hydroxy-N,2,4-trimethylpentanamide (PubChem CID 157214325) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is 5-hydroxy-N,2,4-trimethylpentanamide.
Molecular Properties
| Compound Name | 5-hydroxy-N,2,4-trimethylpentanamide |
| PubChem CID | 157214325 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 5-hydroxy-N,2,4-trimethylpentanamide |
| SMILES | CNC(=O)C(C)CC(C)CO |
| InChI | InChI=1S/C8H17NO2/c1-6(5-10)4-7(2)8(11)9-3/h6-7,10H,4-5H2,1-3H3,(H,9,11) |
| InChIKey | ASFYWTRNMBAKLC-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-hydroxy-N,2,4-trimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-N,2,4-trimethylpentanamide?
The IUPAC name of 5-hydroxy-N,2,4-trimethylpentanamide (CID 157214325) is 5-hydroxy-N,2,4-trimethylpentanamide.
What is the SMILES notation for 5-hydroxy-N,2,4-trimethylpentanamide?
The canonical SMILES for 5-hydroxy-N,2,4-trimethylpentanamide is CNC(=O)C(C)CC(C)CO.
What is the InChIKey of 5-hydroxy-N,2,4-trimethylpentanamide?
The InChIKey is ASFYWTRNMBAKLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2/c1-6(5-10)4-7(2)8(11)9-3/h6-7,10H,4-5H2,1-3H3,(H,9,11).
What are the key properties of 5-hydroxy-N,2,4-trimethylpentanamide?
5-hydroxy-N,2,4-trimethylpentanamide has a molecular weight of 159.23 g/mol, XLogP of 0.39, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-N,2,4-trimethylpentanamide is sourced from PubChem (CID 157214325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).