C15H31NO — CID 17384180
N,2,4-trimethyldodecanamide (PubChem CID 17384180) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is N,2,4-trimethyldodecanamide.
| Compound Name | N,2,4-trimethyldodecanamide |
|---|---|
| PubChem CID | 17384180 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | N,2,4-trimethyldodecanamide |
| SMILES | CCCCCCCCC(C)CC(C)C(=O)NC |
| InChI | InChI=1S/C15H31NO/c1-5-6-7-8-9-10-11-13(2)12-14(3)15(17)16-4/h13-14H,5-12H2,1-4H3,(H,16,17) |
| InChIKey | FDKSOCQVSBZZFI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|