C12H24O2 — CID 163049093
methyl (2R,4S)-2,4-dimethylnonanoate (PubChem CID 163049093) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is methyl (2R,4S)-2,4-dimethylnonanoate.
| Compound Name | methyl (2R,4S)-2,4-dimethylnonanoate |
|---|---|
| PubChem CID | 163049093 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | methyl (2R,4S)-2,4-dimethylnonanoate |
| SMILES | CCCCC[C@H](C)C[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C12H24O2/c1-5-6-7-8-10(2)9-11(3)12(13)14-4/h10-11H,5-9H2,1-4H3/t10-,11+/m0/s1 |
| InChIKey | RKPXEKNNZGWVDH-WDEREUQCSA-N |
| XLogP | 3.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|