C22H43O2- — CID 102514957
2,4-dimethylicosanoate (PubChem CID 102514957) has the molecular formula C22H43O2- and a molecular weight of 339.58 g/mol. Its IUPAC name is 2,4-dimethylicosanoate.
| Compound Name | 2,4-dimethylicosanoate |
|---|---|
| PubChem CID | 102514957 |
| Molecular Formula | C22H43O2- |
| Molecular Weight | 339.58 g/mol |
| Exact Mass | 339.33 |
| IUPAC Name | 2,4-dimethylicosanoate |
| SMILES | CCCCCCCCCCCCCCCCC(C)CC(C)C(=O)[O-] |
| InChI | InChI=1S/C22H44O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(2)19-21(3)22(23)24/h20-21H,4-19H2,1-3H3,(H,23,24)/p-1 |
| InChIKey | COAODRXSFBPEHK-UHFFFAOYSA-M |
| XLogP | 6.27 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.58 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|