About (2R)-2-methylhexanoate
(2R)-2-methylhexanoate (PubChem CID 6999857) has the molecular formula C7H13O2-
and a molecular weight of 129.18 g/mol. Its IUPAC name is (2R)-2-methylhexanoate.
Molecular Properties
| Compound Name | (2R)-2-methylhexanoate |
| PubChem CID | 6999857 |
| Molecular Formula | C7H13O2- |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.09 |
| IUPAC Name | (2R)-2-methylhexanoate |
| SMILES | CCCC[C@@H](C)C(=O)[O-] |
| InChI | InChI=1S/C7H14O2/c1-3-4-5-6(2)7(8)9/h6H,3-5H2,1-2H3,(H,8,9)/p-1/t6-/m1/s1 |
| InChIKey | CVKMFSAVYPAZTQ-ZCFIWIBFSA-M |
| XLogP | 0.56 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-methylhexanoate?
The IUPAC name of (2R)-2-methylhexanoate (CID 6999857) is (2R)-2-methylhexanoate.
What is the SMILES notation for (2R)-2-methylhexanoate?
The canonical SMILES for (2R)-2-methylhexanoate is CCCC[C@@H](C)C(=O)[O-].
What is the InChIKey of (2R)-2-methylhexanoate?
The InChIKey is CVKMFSAVYPAZTQ-ZCFIWIBFSA-M. The full InChI is InChI=1S/C7H14O2/c1-3-4-5-6(2)7(8)9/h6H,3-5H2,1-2H3,(H,8,9)/p-1/t6-/m1/s1.
What are the key properties of (2R)-2-methylhexanoate?
(2R)-2-methylhexanoate has a molecular weight of 129.18 g/mol, XLogP of 0.56, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methylhexanoate is sourced from PubChem (CID 6999857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).