About copper bis(2-methylhexanoate)
copper bis(2-methylhexanoate) (PubChem CID 19768945) has the molecular formula C14H26CuO4
and a molecular weight of 321.90 g/mol. Its IUPAC name is copper bis(2-methylhexanoate).
Molecular Properties
| Compound Name | copper bis(2-methylhexanoate) |
| PubChem CID | 19768945 |
| Molecular Formula | C14H26CuO4 |
| Molecular Weight | 321.90 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | copper bis(2-methylhexanoate) |
| SMILES | CCCCC(C)C(=O)[O-].CCCCC(C)C(=O)[O-].[Cu+2] |
| InChI | InChI=1S/2C7H14O2.Cu/c2*1-3-4-5-6(2)7(8)9;/h2*6H,3-5H2,1-2H3,(H,8,9);/q;;+2/p-2 |
| InChIKey | IVMWVPNXTUAEEE-UHFFFAOYSA-L |
| XLogP | 1.12 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.90 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze copper bis(2-methylhexanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper bis(2-methylhexanoate)?
The IUPAC name of copper bis(2-methylhexanoate) (CID 19768945) is copper bis(2-methylhexanoate).
What is the SMILES notation for copper bis(2-methylhexanoate)?
The canonical SMILES for copper bis(2-methylhexanoate) is CCCCC(C)C(=O)[O-].CCCCC(C)C(=O)[O-].[Cu+2].
What is the InChIKey of copper bis(2-methylhexanoate)?
The InChIKey is IVMWVPNXTUAEEE-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H14O2.Cu/c2*1-3-4-5-6(2)7(8)9;/h2*6H,3-5H2,1-2H3,(H,8,9);/q;;+2/p-2.
What are the key properties of copper bis(2-methylhexanoate)?
copper bis(2-methylhexanoate) has a molecular weight of 321.90 g/mol, XLogP of 1.12, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper bis(2-methylhexanoate) is sourced from PubChem (CID 19768945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).