About lithium 2-methylpentanoate
lithium 2-methylpentanoate (PubChem CID 122554466) has the molecular formula C6H11LiO2
and a molecular weight of 122.09 g/mol. Its IUPAC name is lithium 2-methylpentanoate.
Molecular Properties
| Compound Name | lithium 2-methylpentanoate |
| PubChem CID | 122554466 |
| Molecular Formula | C6H11LiO2 |
| Molecular Weight | 122.09 g/mol |
| Exact Mass | 122.09 |
| IUPAC Name | lithium 2-methylpentanoate |
| SMILES | CCCC(C)C(=O)[O-].[Li+] |
| InChI | InChI=1S/C6H12O2.Li/c1-3-4-5(2)6(7)8;/h5H,3-4H2,1-2H3,(H,7,8);/q;+1/p-1 |
| InChIKey | IESARDCYEIFBJX-UHFFFAOYSA-M |
| XLogP | -2.82 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.09 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze lithium 2-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-methylpentanoate?
The IUPAC name of lithium 2-methylpentanoate (CID 122554466) is lithium 2-methylpentanoate.
What is the SMILES notation for lithium 2-methylpentanoate?
The canonical SMILES for lithium 2-methylpentanoate is CCCC(C)C(=O)[O-].[Li+].
What is the InChIKey of lithium 2-methylpentanoate?
The InChIKey is IESARDCYEIFBJX-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H12O2.Li/c1-3-4-5(2)6(7)8;/h5H,3-4H2,1-2H3,(H,7,8);/q;+1/p-1.
What are the key properties of lithium 2-methylpentanoate?
lithium 2-methylpentanoate has a molecular weight of 122.09 g/mol, XLogP of -2.82, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-methylpentanoate is sourced from PubChem (CID 122554466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).