About lithium;potassium;2-propylpropanedioate
lithium;potassium;2-propylpropanedioate (PubChem CID 139411515) has the molecular formula C6H8KLiO4
and a molecular weight of 190.16 g/mol. Its IUPAC name is lithium;potassium;2-propylpropanedioate.
Molecular Properties
| Compound Name | lithium;potassium;2-propylpropanedioate |
| PubChem CID | 139411515 |
| Molecular Formula | C6H8KLiO4 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | lithium;potassium;2-propylpropanedioate |
| SMILES | CCCC(C(=O)[O-])C(=O)[O-].[K+].[Li+] |
| InChI | InChI=1S/C6H10O4.K.Li/c1-2-3-4(5(7)8)6(9)10;;/h4H,2-3H2,1H3,(H,7,8)(H,9,10);;/q;2*+1/p-2 |
| InChIKey | KXYAVIRQOOGKJL-UHFFFAOYSA-L |
| XLogP | -8.09 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | -8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze lithium;potassium;2-propylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;potassium;2-propylpropanedioate?
The IUPAC name of lithium;potassium;2-propylpropanedioate (CID 139411515) is lithium;potassium;2-propylpropanedioate.
What is the SMILES notation for lithium;potassium;2-propylpropanedioate?
The canonical SMILES for lithium;potassium;2-propylpropanedioate is CCCC(C(=O)[O-])C(=O)[O-].[K+].[Li+].
What is the InChIKey of lithium;potassium;2-propylpropanedioate?
The InChIKey is KXYAVIRQOOGKJL-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H10O4.K.Li/c1-2-3-4(5(7)8)6(9)10;;/h4H,2-3H2,1H3,(H,7,8)(H,9,10);;/q;2*+1/p-2.
What are the key properties of lithium;potassium;2-propylpropanedioate?
lithium;potassium;2-propylpropanedioate has a molecular weight of 190.16 g/mol, XLogP of -8.09, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;potassium;2-propylpropanedioate is sourced from PubChem (CID 139411515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).