About diazanium;2-hexadecylpropanedioate
diazanium;2-hexadecylpropanedioate (PubChem CID 156776490) has the molecular formula C19H42N2O4
and a molecular weight of 362.56 g/mol. Its IUPAC name is diazanium;2-hexadecylpropanedioate.
Molecular Properties
| Compound Name | diazanium;2-hexadecylpropanedioate |
| PubChem CID | 156776490 |
| Molecular Formula | C19H42N2O4 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.31 |
| IUPAC Name | diazanium;2-hexadecylpropanedioate |
| SMILES | CCCCCCCCCCCCCCCCC(C(=O)[O-])C(=O)[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C19H36O4.2H3N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18(20)21)19(22)23;;/h17H,2-16H2,1H3,(H,20,21)(H,22,23);2*1H3 |
| InChIKey | QOBFHIOSMNYXNK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 153.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diazanium;2-hexadecylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;2-hexadecylpropanedioate?
The IUPAC name of diazanium;2-hexadecylpropanedioate (CID 156776490) is diazanium;2-hexadecylpropanedioate.
What is the SMILES notation for diazanium;2-hexadecylpropanedioate?
The canonical SMILES for diazanium;2-hexadecylpropanedioate is CCCCCCCCCCCCCCCCC(C(=O)[O-])C(=O)[O-].[NH4+].[NH4+].
What is the InChIKey of diazanium;2-hexadecylpropanedioate?
The InChIKey is QOBFHIOSMNYXNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O4.2H3N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18(20)21)19(22)23;;/h17H,2-16H2,1H3,(H,20,21)(H,22,23);2*1H3.
What are the key properties of diazanium;2-hexadecylpropanedioate?
diazanium;2-hexadecylpropanedioate has a molecular weight of 362.56 g/mol, XLogP of 3.73, 17 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;2-hexadecylpropanedioate is sourced from PubChem (CID 156776490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).