About potassium;sodium;2-octylpropanedioate
potassium;sodium;2-octylpropanedioate (PubChem CID 139411906) has the molecular formula C11H18KNaO4
and a molecular weight of 276.35 g/mol. Its IUPAC name is potassium;sodium;2-octylpropanedioate.
Molecular Properties
| Compound Name | potassium;sodium;2-octylpropanedioate |
| PubChem CID | 139411906 |
| Molecular Formula | C11H18KNaO4 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | potassium;sodium;2-octylpropanedioate |
| SMILES | CCCCCCCCC(C(=O)[O-])C(=O)[O-].[K+].[Na+] |
| InChI | InChI=1S/C11H20O4.K.Na/c1-2-3-4-5-6-7-8-9(10(12)13)11(14)15;;/h9H,2-8H2,1H3,(H,12,13)(H,14,15);;/q;2*+1/p-2 |
| InChIKey | YJELHCWHQFDOAU-UHFFFAOYSA-L |
| XLogP | -6.14 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | -6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze potassium;sodium;2-octylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;sodium;2-octylpropanedioate?
The IUPAC name of potassium;sodium;2-octylpropanedioate (CID 139411906) is potassium;sodium;2-octylpropanedioate.
What is the SMILES notation for potassium;sodium;2-octylpropanedioate?
The canonical SMILES for potassium;sodium;2-octylpropanedioate is CCCCCCCCC(C(=O)[O-])C(=O)[O-].[K+].[Na+].
What is the InChIKey of potassium;sodium;2-octylpropanedioate?
The InChIKey is YJELHCWHQFDOAU-UHFFFAOYSA-L. The full InChI is InChI=1S/C11H20O4.K.Na/c1-2-3-4-5-6-7-8-9(10(12)13)11(14)15;;/h9H,2-8H2,1H3,(H,12,13)(H,14,15);;/q;2*+1/p-2.
What are the key properties of potassium;sodium;2-octylpropanedioate?
potassium;sodium;2-octylpropanedioate has a molecular weight of 276.35 g/mol, XLogP of -6.14, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;sodium;2-octylpropanedioate is sourced from PubChem (CID 139411906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).