About disodium;2-undecylpropanedioate
disodium;2-undecylpropanedioate (PubChem CID 139411931) has the molecular formula C14H24Na2O4
and a molecular weight of 302.32 g/mol. Its IUPAC name is disodium;2-undecylpropanedioate.
Molecular Properties
| Compound Name | disodium;2-undecylpropanedioate |
| PubChem CID | 139411931 |
| Molecular Formula | C14H24Na2O4 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | disodium;2-undecylpropanedioate |
| SMILES | CCCCCCCCCCCC(C(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C14H26O4.2Na/c1-2-3-4-5-6-7-8-9-10-11-12(13(15)16)14(17)18;;/h12H,2-11H2,1H3,(H,15,16)(H,17,18);;/q;2*+1/p-2 |
| InChIKey | PJDCQFWDRCADJP-UHFFFAOYSA-L |
| XLogP | -4.97 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | -4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze disodium;2-undecylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-undecylpropanedioate?
The IUPAC name of disodium;2-undecylpropanedioate (CID 139411931) is disodium;2-undecylpropanedioate.
What is the SMILES notation for disodium;2-undecylpropanedioate?
The canonical SMILES for disodium;2-undecylpropanedioate is CCCCCCCCCCCC(C(=O)[O-])C(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;2-undecylpropanedioate?
The InChIKey is PJDCQFWDRCADJP-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H26O4.2Na/c1-2-3-4-5-6-7-8-9-10-11-12(13(15)16)14(17)18;;/h12H,2-11H2,1H3,(H,15,16)(H,17,18);;/q;2*+1/p-2.
What are the key properties of disodium;2-undecylpropanedioate?
disodium;2-undecylpropanedioate has a molecular weight of 302.32 g/mol, XLogP of -4.97, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-undecylpropanedioate is sourced from PubChem (CID 139411931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).