About dilithium;2-decylpropanedioate
dilithium;2-decylpropanedioate (PubChem CID 139411609) has the molecular formula C13H22Li2O4
and a molecular weight of 256.20 g/mol. Its IUPAC name is dilithium;2-decylpropanedioate.
Molecular Properties
| Compound Name | dilithium;2-decylpropanedioate |
| PubChem CID | 139411609 |
| Molecular Formula | C13H22Li2O4 |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | dilithium;2-decylpropanedioate |
| SMILES | CCCCCCCCCCC(C(=O)[O-])C(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C13H24O4.2Li/c1-2-3-4-5-6-7-8-9-10-11(12(14)15)13(16)17;;/h11H,2-10H2,1H3,(H,14,15)(H,16,17);;/q;2*+1/p-2 |
| InChIKey | UKGKNQIJNLNXJE-UHFFFAOYSA-L |
| XLogP | -5.36 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | -5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dilithium;2-decylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;2-decylpropanedioate?
The IUPAC name of dilithium;2-decylpropanedioate (CID 139411609) is dilithium;2-decylpropanedioate.
What is the SMILES notation for dilithium;2-decylpropanedioate?
The canonical SMILES for dilithium;2-decylpropanedioate is CCCCCCCCCCC(C(=O)[O-])C(=O)[O-].[Li+].[Li+].
What is the InChIKey of dilithium;2-decylpropanedioate?
The InChIKey is UKGKNQIJNLNXJE-UHFFFAOYSA-L. The full InChI is InChI=1S/C13H24O4.2Li/c1-2-3-4-5-6-7-8-9-10-11(12(14)15)13(16)17;;/h11H,2-10H2,1H3,(H,14,15)(H,16,17);;/q;2*+1/p-2.
What are the key properties of dilithium;2-decylpropanedioate?
dilithium;2-decylpropanedioate has a molecular weight of 256.20 g/mol, XLogP of -5.36, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;2-decylpropanedioate is sourced from PubChem (CID 139411609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).