About dilithium;2-pentylpropanedioate
dilithium;2-pentylpropanedioate (PubChem CID 139411543) has the molecular formula C8H12Li2O4
and a molecular weight of 186.06 g/mol. Its IUPAC name is dilithium;2-pentylpropanedioate.
Molecular Properties
| Compound Name | dilithium;2-pentylpropanedioate |
| PubChem CID | 139411543 |
| Molecular Formula | C8H12Li2O4 |
| Molecular Weight | 186.06 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | dilithium;2-pentylpropanedioate |
| SMILES | CCCCCC(C(=O)[O-])C(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C8H14O4.2Li/c1-2-3-4-5-6(7(9)10)8(11)12;;/h6H,2-5H2,1H3,(H,9,10)(H,11,12);;/q;2*+1/p-2 |
| InChIKey | CPBKUKWJKGQLRF-UHFFFAOYSA-L |
| XLogP | -7.31 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.06 |
| LogP ≤ 5 | -7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dilithium;2-pentylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;2-pentylpropanedioate?
The IUPAC name of dilithium;2-pentylpropanedioate (CID 139411543) is dilithium;2-pentylpropanedioate.
What is the SMILES notation for dilithium;2-pentylpropanedioate?
The canonical SMILES for dilithium;2-pentylpropanedioate is CCCCCC(C(=O)[O-])C(=O)[O-].[Li+].[Li+].
What is the InChIKey of dilithium;2-pentylpropanedioate?
The InChIKey is CPBKUKWJKGQLRF-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H14O4.2Li/c1-2-3-4-5-6(7(9)10)8(11)12;;/h6H,2-5H2,1H3,(H,9,10)(H,11,12);;/q;2*+1/p-2.
What are the key properties of dilithium;2-pentylpropanedioate?
dilithium;2-pentylpropanedioate has a molecular weight of 186.06 g/mol, XLogP of -7.31, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;2-pentylpropanedioate is sourced from PubChem (CID 139411543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).