About lithium;potassium;2-(2-ethylpentyl)propanedioate
lithium;potassium;2-(2-ethylpentyl)propanedioate (PubChem CID 139411964) has the molecular formula C10H16KLiO4
and a molecular weight of 246.27 g/mol. Its IUPAC name is lithium;potassium;2-(2-ethylpentyl)propanedioate.
Molecular Properties
| Compound Name | lithium;potassium;2-(2-ethylpentyl)propanedioate |
| PubChem CID | 139411964 |
| Molecular Formula | C10H16KLiO4 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | lithium;potassium;2-(2-ethylpentyl)propanedioate |
| SMILES | CCCC(CC)CC(C(=O)[O-])C(=O)[O-].[K+].[Li+] |
| InChI | InChI=1S/C10H18O4.K.Li/c1-3-5-7(4-2)6-8(9(11)12)10(13)14;;/h7-8H,3-6H2,1-2H3,(H,11,12)(H,13,14);;/q;2*+1/p-2 |
| InChIKey | CKKHYPPTRSKQBT-UHFFFAOYSA-L |
| XLogP | -6.67 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | -6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze lithium;potassium;2-(2-ethylpentyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;potassium;2-(2-ethylpentyl)propanedioate?
The IUPAC name of lithium;potassium;2-(2-ethylpentyl)propanedioate (CID 139411964) is lithium;potassium;2-(2-ethylpentyl)propanedioate.
What is the SMILES notation for lithium;potassium;2-(2-ethylpentyl)propanedioate?
The canonical SMILES for lithium;potassium;2-(2-ethylpentyl)propanedioate is CCCC(CC)CC(C(=O)[O-])C(=O)[O-].[K+].[Li+].
What is the InChIKey of lithium;potassium;2-(2-ethylpentyl)propanedioate?
The InChIKey is CKKHYPPTRSKQBT-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H18O4.K.Li/c1-3-5-7(4-2)6-8(9(11)12)10(13)14;;/h7-8H,3-6H2,1-2H3,(H,11,12)(H,13,14);;/q;2*+1/p-2.
What are the key properties of lithium;potassium;2-(2-ethylpentyl)propanedioate?
lithium;potassium;2-(2-ethylpentyl)propanedioate has a molecular weight of 246.27 g/mol, XLogP of -6.67, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;potassium;2-(2-ethylpentyl)propanedioate is sourced from PubChem (CID 139411964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).