About magnesium 2-ethylpropanedioate
magnesium 2-ethylpropanedioate (PubChem CID 22261989) has the molecular formula C5H6MgO4
and a molecular weight of 154.40 g/mol. Its IUPAC name is magnesium 2-ethylpropanedioate.
Molecular Properties
| Compound Name | magnesium 2-ethylpropanedioate |
| PubChem CID | 22261989 |
| Molecular Formula | C5H6MgO4 |
| Molecular Weight | 154.40 g/mol |
| Exact Mass | 154.01 |
| IUPAC Name | magnesium 2-ethylpropanedioate |
| SMILES | CCC(C(=O)[O-])C(=O)[O-].[Mg+2] |
| InChI | InChI=1S/C5H8O4.Mg/c1-2-3(4(6)7)5(8)9;/h3H,2H2,1H3,(H,6,7)(H,8,9);/q;+2/p-2 |
| InChIKey | NWELDCIRFBARNC-UHFFFAOYSA-L |
| XLogP | -2.87 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.40 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze magnesium 2-ethylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium 2-ethylpropanedioate?
The IUPAC name of magnesium 2-ethylpropanedioate (CID 22261989) is magnesium 2-ethylpropanedioate.
What is the SMILES notation for magnesium 2-ethylpropanedioate?
The canonical SMILES for magnesium 2-ethylpropanedioate is CCC(C(=O)[O-])C(=O)[O-].[Mg+2].
What is the InChIKey of magnesium 2-ethylpropanedioate?
The InChIKey is NWELDCIRFBARNC-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H8O4.Mg/c1-2-3(4(6)7)5(8)9;/h3H,2H2,1H3,(H,6,7)(H,8,9);/q;+2/p-2.
What are the key properties of magnesium 2-ethylpropanedioate?
magnesium 2-ethylpropanedioate has a molecular weight of 154.40 g/mol, XLogP of -2.87, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium 2-ethylpropanedioate is sourced from PubChem (CID 22261989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).