About 2-methylbutanoate
2-methylbutanoate (PubChem CID 91073357) has the molecular formula C10H18O4-2
and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-methylbutanoate.
Molecular Properties
| Compound Name | 2-methylbutanoate |
| PubChem CID | 91073357 |
| Molecular Formula | C10H18O4-2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-methylbutanoate |
| SMILES | CCC(C)C(=O)[O-].CCC(C)C(=O)[O-] |
| InChI | InChI=1S/2C5H10O2/c2*1-3-4(2)5(6)7/h2*4H,3H2,1-2H3,(H,6,7)/p-2 |
| InChIKey | AJPJJICZVBGWEX-UHFFFAOYSA-L |
| XLogP | -0.44 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutanoate?
The IUPAC name of 2-methylbutanoate (CID 91073357) is 2-methylbutanoate.
What is the SMILES notation for 2-methylbutanoate?
The canonical SMILES for 2-methylbutanoate is CCC(C)C(=O)[O-].CCC(C)C(=O)[O-].
What is the InChIKey of 2-methylbutanoate?
The InChIKey is AJPJJICZVBGWEX-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H10O2/c2*1-3-4(2)5(6)7/h2*4H,3H2,1-2H3,(H,6,7)/p-2.
What are the key properties of 2-methylbutanoate?
2-methylbutanoate has a molecular weight of 202.25 g/mol, XLogP of -0.44, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutanoate is sourced from PubChem (CID 91073357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).