About bis(2-methylbutanoate);niobium(2+)
bis(2-methylbutanoate);niobium(2+) (PubChem CID 18939928) has the molecular formula C10H18NbO4
and a molecular weight of 295.16 g/mol. Its IUPAC name is bis(2-methylbutanoate);niobium(2+).
Molecular Properties
| Compound Name | bis(2-methylbutanoate);niobium(2+) |
| PubChem CID | 18939928 |
| Molecular Formula | C10H18NbO4 |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | bis(2-methylbutanoate);niobium(2+) |
| SMILES | CCC(C)C(=O)[O-].CCC(C)C(=O)[O-].[Nb+2] |
| InChI | InChI=1S/2C5H10O2.Nb/c2*1-3-4(2)5(6)7;/h2*4H,3H2,1-2H3,(H,6,7);/q;;+2/p-2 |
| InChIKey | MASYNVDWCWFQOQ-UHFFFAOYSA-L |
| XLogP | -0.44 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(2-methylbutanoate);niobium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylbutanoate);niobium(2+)?
The IUPAC name of bis(2-methylbutanoate);niobium(2+) (CID 18939928) is bis(2-methylbutanoate);niobium(2+).
What is the SMILES notation for bis(2-methylbutanoate);niobium(2+)?
The canonical SMILES for bis(2-methylbutanoate);niobium(2+) is CCC(C)C(=O)[O-].CCC(C)C(=O)[O-].[Nb+2].
What is the InChIKey of bis(2-methylbutanoate);niobium(2+)?
The InChIKey is MASYNVDWCWFQOQ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H10O2.Nb/c2*1-3-4(2)5(6)7;/h2*4H,3H2,1-2H3,(H,6,7);/q;;+2/p-2.
What are the key properties of bis(2-methylbutanoate);niobium(2+)?
bis(2-methylbutanoate);niobium(2+) has a molecular weight of 295.16 g/mol, XLogP of -0.44, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylbutanoate);niobium(2+) is sourced from PubChem (CID 18939928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).