About 2-methylbutanoate;tetrakis(3-methylbutyl)azanium
2-methylbutanoate;tetrakis(3-methylbutyl)azanium (PubChem CID 155660503) has the molecular formula C25H53NO2
and a molecular weight of 399.70 g/mol. Its IUPAC name is 2-methylbutanoate;tetrakis(3-methylbutyl)azanium.
Molecular Properties
| Compound Name | 2-methylbutanoate;tetrakis(3-methylbutyl)azanium |
| PubChem CID | 155660503 |
| Molecular Formula | C25H53NO2 |
| Molecular Weight | 399.70 g/mol |
| Exact Mass | 399.41 |
| IUPAC Name | 2-methylbutanoate;tetrakis(3-methylbutyl)azanium |
| SMILES | CC(C)CC[N+](CCC(C)C)(CCC(C)C)CCC(C)C.CCC(C)C(=O)[O-] |
| InChI | InChI=1S/C20H44N.C5H10O2/c1-17(2)9-13-21(14-10-18(3)4,15-11-19(5)6)16-12-20(7)8;1-3-4(2)5(6)7/h17-20H,9-16H2,1-8H3;4H,3H2,1-2H3,(H,6,7)/q+1;/p-1 |
| InChIKey | XZMGZMWCFPVPOP-UHFFFAOYSA-M |
| XLogP | 5.77 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.70 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutanoate;tetrakis(3-methylbutyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutanoate;tetrakis(3-methylbutyl)azanium?
The IUPAC name of 2-methylbutanoate;tetrakis(3-methylbutyl)azanium (CID 155660503) is 2-methylbutanoate;tetrakis(3-methylbutyl)azanium.
What is the SMILES notation for 2-methylbutanoate;tetrakis(3-methylbutyl)azanium?
The canonical SMILES for 2-methylbutanoate;tetrakis(3-methylbutyl)azanium is CC(C)CC[N+](CCC(C)C)(CCC(C)C)CCC(C)C.CCC(C)C(=O)[O-].
What is the InChIKey of 2-methylbutanoate;tetrakis(3-methylbutyl)azanium?
The InChIKey is XZMGZMWCFPVPOP-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H44N.C5H10O2/c1-17(2)9-13-21(14-10-18(3)4,15-11-19(5)6)16-12-20(7)8;1-3-4(2)5(6)7/h17-20H,9-16H2,1-8H3;4H,3H2,1-2H3,(H,6,7)/q+1;/p-1.
What are the key properties of 2-methylbutanoate;tetrakis(3-methylbutyl)azanium?
2-methylbutanoate;tetrakis(3-methylbutyl)azanium has a molecular weight of 399.70 g/mol, XLogP of 5.77, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutanoate;tetrakis(3-methylbutyl)azanium is sourced from PubChem (CID 155660503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).