About 2-hydroxypropanoate;tetrabutylazanium
2-hydroxypropanoate;tetrabutylazanium (PubChem CID 15404302) has the molecular formula C19H41NO3
and a molecular weight of 331.54 g/mol. Its IUPAC name is 2-hydroxypropanoate;tetrabutylazanium.
Molecular Properties
| Compound Name | 2-hydroxypropanoate;tetrabutylazanium |
| PubChem CID | 15404302 |
| Molecular Formula | C19H41NO3 |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.31 |
| IUPAC Name | 2-hydroxypropanoate;tetrabutylazanium |
| SMILES | CC(O)C(=O)[O-].CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H36N.C3H6O3/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2(4)3(5)6/h5-16H2,1-4H3;2,4H,1H3,(H,5,6)/q+1;/p-1 |
| InChIKey | MSLTZKLJPHUCPU-UHFFFAOYSA-M |
| XLogP | 3.12 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropanoate;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropanoate;tetrabutylazanium?
The IUPAC name of 2-hydroxypropanoate;tetrabutylazanium (CID 15404302) is 2-hydroxypropanoate;tetrabutylazanium.
What is the SMILES notation for 2-hydroxypropanoate;tetrabutylazanium?
The canonical SMILES for 2-hydroxypropanoate;tetrabutylazanium is CC(O)C(=O)[O-].CCCC[N+](CCCC)(CCCC)CCCC.
What is the InChIKey of 2-hydroxypropanoate;tetrabutylazanium?
The InChIKey is MSLTZKLJPHUCPU-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.C3H6O3/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2(4)3(5)6/h5-16H2,1-4H3;2,4H,1H3,(H,5,6)/q+1;/p-1.
What are the key properties of 2-hydroxypropanoate;tetrabutylazanium?
2-hydroxypropanoate;tetrabutylazanium has a molecular weight of 331.54 g/mol, XLogP of 3.12, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropanoate;tetrabutylazanium is sourced from PubChem (CID 15404302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).