C20H42NO6+ — CID 87904025
2,3-dihydroxybutanedioic acid;tetrabutylazanium (PubChem CID 87904025) has the molecular formula C20H42NO6+ and a molecular weight of 392.56 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;tetrabutylazanium.
| Compound Name | 2,3-dihydroxybutanedioic acid;tetrabutylazanium |
|---|---|
| PubChem CID | 87904025 |
| Molecular Formula | C20H42NO6+ |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.30 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C16H36N.C4H6O6/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;5-1(3(7)8)2(6)4(9)10/h5-16H2,1-4H3;1-2,5-6H,(H,7,8)(H,9,10)/q+1; |
| InChIKey | CWBICVDLKRDYBG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|