About pentanedioic acid;tetrabutylazanium
pentanedioic acid;tetrabutylazanium (PubChem CID 87067487) has the molecular formula C21H44NO4+
and a molecular weight of 374.59 g/mol. Its IUPAC name is pentanedioic acid;tetrabutylazanium.
Molecular Properties
| Compound Name | pentanedioic acid;tetrabutylazanium |
| PubChem CID | 87067487 |
| Molecular Formula | C21H44NO4+ |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.33 |
| IUPAC Name | pentanedioic acid;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=C(O)CCCC(=O)O |
| InChI | InChI=1S/C16H36N.C5H8O4/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;6-4(7)2-1-3-5(8)9/h5-16H2,1-4H3;1-3H2,(H,6,7)(H,8,9)/q+1; |
| InChIKey | CUZXIJGJUBBUFU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze pentanedioic acid;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanedioic acid;tetrabutylazanium?
The IUPAC name of pentanedioic acid;tetrabutylazanium (CID 87067487) is pentanedioic acid;tetrabutylazanium.
What is the SMILES notation for pentanedioic acid;tetrabutylazanium?
The canonical SMILES for pentanedioic acid;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.O=C(O)CCCC(=O)O.
What is the InChIKey of pentanedioic acid;tetrabutylazanium?
The InChIKey is CUZXIJGJUBBUFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N.C5H8O4/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;6-4(7)2-1-3-5(8)9/h5-16H2,1-4H3;1-3H2,(H,6,7)(H,8,9)/q+1;.
What are the key properties of pentanedioic acid;tetrabutylazanium?
pentanedioic acid;tetrabutylazanium has a molecular weight of 374.59 g/mol, XLogP of 5.33, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentanedioic acid;tetrabutylazanium is sourced from PubChem (CID 87067487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).