About hexadecanoic acid;pentanedioic acid
hexadecanoic acid;pentanedioic acid (PubChem CID 159789250) has the molecular formula C21H40O6
and a molecular weight of 388.55 g/mol. Its IUPAC name is hexadecanoic acid;pentanedioic acid.
Molecular Properties
| Compound Name | hexadecanoic acid;pentanedioic acid |
| PubChem CID | 159789250 |
| Molecular Formula | C21H40O6 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | hexadecanoic acid;pentanedioic acid |
| SMILES | CCCCCCCCCCCCCCCC(=O)O.O=C(O)CCCC(=O)O |
| InChI | InChI=1S/C16H32O2.C5H8O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;6-4(7)2-1-3-5(8)9/h2-15H2,1H3,(H,17,18);1-3H2,(H,6,7)(H,8,9) |
| InChIKey | NIIQBLMHUALGBL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexadecanoic acid;pentanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecanoic acid;pentanedioic acid?
The IUPAC name of hexadecanoic acid;pentanedioic acid (CID 159789250) is hexadecanoic acid;pentanedioic acid.
What is the SMILES notation for hexadecanoic acid;pentanedioic acid?
The canonical SMILES for hexadecanoic acid;pentanedioic acid is CCCCCCCCCCCCCCCC(=O)O.O=C(O)CCCC(=O)O.
What is the InChIKey of hexadecanoic acid;pentanedioic acid?
The InChIKey is NIIQBLMHUALGBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2.C5H8O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;6-4(7)2-1-3-5(8)9/h2-15H2,1H3,(H,17,18);1-3H2,(H,6,7)(H,8,9).
What are the key properties of hexadecanoic acid;pentanedioic acid?
hexadecanoic acid;pentanedioic acid has a molecular weight of 388.55 g/mol, XLogP of 5.88, 18 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecanoic acid;pentanedioic acid is sourced from PubChem (CID 159789250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).