About bis(tetrabutylazanium);carbonate
bis(tetrabutylazanium);carbonate (PubChem CID 14746847) has the molecular formula C33H72N2O3
and a molecular weight of 544.95 g/mol. Its IUPAC name is bis(tetrabutylazanium);carbonate.
Molecular Properties
| Compound Name | bis(tetrabutylazanium);carbonate |
| PubChem CID | 14746847 |
| Molecular Formula | C33H72N2O3 |
| Molecular Weight | 544.95 g/mol |
| Exact Mass | 544.55 |
| IUPAC Name | bis(tetrabutylazanium);carbonate |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC.O=C([O-])[O-] |
| InChI | InChI=1S/2C16H36N.CH2O3/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3)4/h2*5-16H2,1-4H3;(H2,2,3,4)/q2*+1;/p-2 |
| InChIKey | UVVFKNZCYIIHGM-UHFFFAOYSA-L |
| XLogP | 7.56 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 544.95 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis(tetrabutylazanium);carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(tetrabutylazanium);carbonate?
The IUPAC name of bis(tetrabutylazanium);carbonate (CID 14746847) is bis(tetrabutylazanium);carbonate.
What is the SMILES notation for bis(tetrabutylazanium);carbonate?
The canonical SMILES for bis(tetrabutylazanium);carbonate is CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC.O=C([O-])[O-].
What is the InChIKey of bis(tetrabutylazanium);carbonate?
The InChIKey is UVVFKNZCYIIHGM-UHFFFAOYSA-L. The full InChI is InChI=1S/2C16H36N.CH2O3/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3)4/h2*5-16H2,1-4H3;(H2,2,3,4)/q2*+1;/p-2.
What are the key properties of bis(tetrabutylazanium);carbonate?
bis(tetrabutylazanium);carbonate has a molecular weight of 544.95 g/mol, XLogP of 7.56, 24 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(tetrabutylazanium);carbonate is sourced from PubChem (CID 14746847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).