C32H66N2O6 — CID 87376086
(E)-but-2-enedioate;bis(tributyl(2-hydroxyethyl)azanium) (PubChem CID 87376086) has the molecular formula C32H66N2O6 and a molecular weight of 574.89 g/mol. Its IUPAC name is (E)-but-2-enedioate;bis(tributyl(2-hydroxyethyl)azanium).
| Compound Name | (E)-but-2-enedioate;bis(tributyl(2-hydroxyethyl)azanium) |
|---|---|
| PubChem CID | 87376086 |
| Molecular Formula | C32H66N2O6 |
| Molecular Weight | 574.89 g/mol |
| Exact Mass | 574.49 |
| IUPAC Name | (E)-but-2-enedioate;bis(tributyl(2-hydroxyethyl)azanium) |
| SMILES | CCCC[N+](CCO)(CCCC)CCCC.CCCC[N+](CCO)(CCCC)CCCC.O=C([O-])/C=C/C(=O)[O-] |
| InChI | InChI=1S/2C14H32NO.C4H4O4/c2*1-4-7-10-15(13-14-16,11-8-5-2)12-9-6-3;5-3(6)1-2-4(7)8/h2*16H,4-14H2,1-3H3;1-2H,(H,5,6)(H,7,8)/q2*+1;/p-2/b;;2-1+ |
| InChIKey | NQSLVOWEEVKEOH-WXXKFALUSA-L |
| XLogP | 3.43 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.89 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|