C18H35NO4 — CID 87749569
(Z)-4-hydroxy-4-oxobut-2-enoate;tributyl(ethyl)azanium (PubChem CID 87749569) has the molecular formula C18H35NO4 and a molecular weight of 329.48 g/mol. Its IUPAC name is (Z)-4-hydroxy-4-oxobut-2-enoate;tributyl(ethyl)azanium.
| Compound Name | (Z)-4-hydroxy-4-oxobut-2-enoate;tributyl(ethyl)azanium |
|---|---|
| PubChem CID | 87749569 |
| Molecular Formula | C18H35NO4 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | (Z)-4-hydroxy-4-oxobut-2-enoate;tributyl(ethyl)azanium |
| SMILES | CCCC[N+](CC)(CCCC)CCCC.O=C([O-])/C=C\C(=O)O |
| InChI | InChI=1S/C14H32N.C4H4O4/c1-5-9-12-15(8-4,13-10-6-2)14-11-7-3;5-3(6)1-2-4(7)8/h5-14H2,1-4H3;1-2H,(H,5,6)(H,7,8)/q+1;/p-1/b;2-1- |
| InChIKey | XMALBEDLRZUOAZ-BTJKTKAUSA-M |
| XLogP | 2.60 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|