C15H30NO2+ — CID 170124321
(S)-2-[(E)-but-2-enoyl]oxyethyl-butyl-ethyl-propylazanium (PubChem CID 170124321) has the molecular formula C15H30NO2+ and a molecular weight of 256.41 g/mol. Its IUPAC name is (S)-2-[(E)-but-2-enoyl]oxyethyl-butyl-ethyl-propylazanium.
| Compound Name | (S)-2-[(E)-but-2-enoyl]oxyethyl-butyl-ethyl-propylazanium |
|---|---|
| PubChem CID | 170124321 |
| Molecular Formula | C15H30NO2+ |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.23 |
| IUPAC Name | (S)-2-[(E)-but-2-enoyl]oxyethyl-butyl-ethyl-propylazanium |
| SMILES | C/C=C/C(=O)OCC[N@@+](CC)(CCC)CCCC |
| InChI | InChI=1S/C15H30NO2/c1-5-9-12-16(8-4,11-7-3)13-14-18-15(17)10-6-2/h6,10H,5,7-9,11-14H2,1-4H3/q+1/b10-6+/t16-/m0/s1 |
| InChIKey | YUVRFRLUYGULEX-DHINHOHASA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|