C18H34NO2+ — CID 170177702
butyl-ethyl-[2-[(Z,2E)-2-ethylidenepent-3-enoyl]oxyethyl]-propylazanium (PubChem CID 170177702) has the molecular formula C18H34NO2+ and a molecular weight of 296.48 g/mol. Its IUPAC name is butyl-ethyl-[2-[(Z,2E)-2-ethylidenepent-3-enoyl]oxyethyl]-propylazanium.
| Compound Name | butyl-ethyl-[2-[(Z,2E)-2-ethylidenepent-3-enoyl]oxyethyl]-propylazanium |
|---|---|
| PubChem CID | 170177702 |
| Molecular Formula | C18H34NO2+ |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | butyl-ethyl-[2-[(Z,2E)-2-ethylidenepent-3-enoyl]oxyethyl]-propylazanium |
| SMILES | C/C=C\C(=C/C)C(=O)OCC[N+](CC)(CCC)CCCC |
| InChI | InChI=1S/C18H34NO2/c1-6-11-14-19(10-5,13-8-3)15-16-21-18(20)17(9-4)12-7-2/h7,9,12H,6,8,10-11,13-16H2,1-5H3/q+1/b12-7-,17-9+ |
| InChIKey | SLDJLWRJHITHIC-LVGALYMUSA-N |
| XLogP | 4.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|