2-methoxyethyl 2-ethylidenepent-3-enoate

C10H16O3 — CID 123997768

IUPAC2-methoxyethyl 2-ethylidenepent-3-enoate
SMILESCC=CC(=CC)C(=O)OCCOC
InChIInChI=1S/C10H16O3/c1-4-6-9(5-2)10(11)13-8-7-12-3/h4-6H,7-8H2,1-3H3
InChIKeySFFGHMFPQCISOO-UHFFFAOYSA-N
MW184.23 g/mol
LogP1.70
Rot. Bonds5

About 2-methoxyethyl 2-ethylidenepent-3-enoate

2-methoxyethyl 2-ethylidenepent-3-enoate (PubChem CID 123997768) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is 2-methoxyethyl 2-ethylidenepent-3-enoate.

Molecular Properties

Compound Name2-methoxyethyl 2-ethylidenepent-3-enoate
PubChem CID123997768
Molecular FormulaC10H16O3
Molecular Weight184.23 g/mol
Exact Mass184.11
IUPAC Name2-methoxyethyl 2-ethylidenepent-3-enoate
SMILESCC=CC(=CC)C(=O)OCCOC
InChIInChI=1S/C10H16O3/c1-4-6-9(5-2)10(11)13-8-7-12-3/h4-6H,7-8H2,1-3H3
InChIKeySFFGHMFPQCISOO-UHFFFAOYSA-N
XLogP1.70
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.23
LogP ≤ 51.70
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 2-methoxyethyl 2-ethylidenepent-3-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methoxyethyl 2-ethylidenepent-3-enoate?
The IUPAC name of 2-methoxyethyl 2-ethylidenepent-3-enoate (CID 123997768) is 2-methoxyethyl 2-ethylidenepent-3-enoate.
What is the SMILES notation for 2-methoxyethyl 2-ethylidenepent-3-enoate?
The canonical SMILES for 2-methoxyethyl 2-ethylidenepent-3-enoate is CC=CC(=CC)C(=O)OCCOC.
What is the InChIKey of 2-methoxyethyl 2-ethylidenepent-3-enoate?
The InChIKey is SFFGHMFPQCISOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-4-6-9(5-2)10(11)13-8-7-12-3/h4-6H,7-8H2,1-3H3.
What are the key properties of 2-methoxyethyl 2-ethylidenepent-3-enoate?
2-methoxyethyl 2-ethylidenepent-3-enoate has a molecular weight of 184.23 g/mol, XLogP of 1.70, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl 2-ethylidenepent-3-enoate is sourced from PubChem (CID 123997768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).