About 1-O-(2-but-2-enoyloxyethyl) 3-O-methyl 2-diazopropanedioate
1-O-(2-but-2-enoyloxyethyl) 3-O-methyl 2-diazopropanedioate (PubChem CID 175879767) has the molecular formula C10H12N2O6
and a molecular weight of 256.21 g/mol. Its IUPAC name is 1-O-(2-but-2-enoyloxyethyl) 3-O-methyl 2-diazopropanedioate.
Molecular Properties
| Compound Name | 1-O-(2-but-2-enoyloxyethyl) 3-O-methyl 2-diazopropanedioate |
| PubChem CID | 175879767 |
| Molecular Formula | C10H12N2O6 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 1-O-(2-but-2-enoyloxyethyl) 3-O-methyl 2-diazopropanedioate |
| SMILES | CC=CC(=O)OCCOC(=O)C(=[N+]=[N-])C(=O)OC |
| InChI | InChI=1S/C10H12N2O6/c1-3-4-7(13)17-5-6-18-10(15)8(12-11)9(14)16-2/h3-4H,5-6H2,1-2H3 |
| InChIKey | IPBBGTGIXBWKCW-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 115.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(2-but-2-enoyloxyethyl) 3-O-methyl 2-diazopropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(2-but-2-enoyloxyethyl) 3-O-methyl 2-diazopropanedioate?
The IUPAC name of 1-O-(2-but-2-enoyloxyethyl) 3-O-methyl 2-diazopropanedioate (CID 175879767) is 1-O-(2-but-2-enoyloxyethyl) 3-O-methyl 2-diazopropanedioate.
What is the SMILES notation for 1-O-(2-but-2-enoyloxyethyl) 3-O-methyl 2-diazopropanedioate?
The canonical SMILES for 1-O-(2-but-2-enoyloxyethyl) 3-O-methyl 2-diazopropanedioate is CC=CC(=O)OCCOC(=O)C(=[N+]=[N-])C(=O)OC.
What is the InChIKey of 1-O-(2-but-2-enoyloxyethyl) 3-O-methyl 2-diazopropanedioate?
The InChIKey is IPBBGTGIXBWKCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O6/c1-3-4-7(13)17-5-6-18-10(15)8(12-11)9(14)16-2/h3-4H,5-6H2,1-2H3.
What are the key properties of 1-O-(2-but-2-enoyloxyethyl) 3-O-methyl 2-diazopropanedioate?
1-O-(2-but-2-enoyloxyethyl) 3-O-methyl 2-diazopropanedioate has a molecular weight of 256.21 g/mol, XLogP of -0.51, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(2-but-2-enoyloxyethyl) 3-O-methyl 2-diazopropanedioate is sourced from PubChem (CID 175879767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).