C10H14Br2O6 — CID 11811204
bis(2-methoxyethyl) (E)-2,3-dibromobut-2-enedioate (PubChem CID 11811204) has the molecular formula C10H14Br2O6 and a molecular weight of 390.02 g/mol. Its IUPAC name is bis(2-methoxyethyl) (E)-2,3-dibromobut-2-enedioate.
| Compound Name | bis(2-methoxyethyl) (E)-2,3-dibromobut-2-enedioate |
|---|---|
| PubChem CID | 11811204 |
| Molecular Formula | C10H14Br2O6 |
| Molecular Weight | 390.02 g/mol |
| Exact Mass | 387.92 |
| IUPAC Name | bis(2-methoxyethyl) (E)-2,3-dibromobut-2-enedioate |
| SMILES | COCCOC(=O)/C(Br)=C(\Br)C(=O)OCCOC |
| InChI | InChI=1S/C10H14Br2O6/c1-15-3-5-17-9(13)7(11)8(12)10(14)18-6-4-16-2/h3-6H2,1-2H3/b8-7+ |
| InChIKey | URTXJVDYKKDJNO-BQYQJAHWSA-N |
| XLogP | 1.37 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.02 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|