C10H20N2O6 — CID 118910846
2-methoxyethyl N-[2-(2-methoxyethoxycarbonylamino)ethyl]carbamate (PubChem CID 118910846) has the molecular formula C10H20N2O6 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-methoxyethyl N-[2-(2-methoxyethoxycarbonylamino)ethyl]carbamate.
| Compound Name | 2-methoxyethyl N-[2-(2-methoxyethoxycarbonylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 118910846 |
| Molecular Formula | C10H20N2O6 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 2-methoxyethyl N-[2-(2-methoxyethoxycarbonylamino)ethyl]carbamate |
| SMILES | COCCOC(=O)NCCNC(=O)OCCOC |
| InChI | InChI=1S/C10H20N2O6/c1-15-5-7-17-9(13)11-3-4-12-10(14)18-8-6-16-2/h3-8H2,1-2H3,(H,11,13)(H,12,14) |
| InChIKey | CLPUSZZULJIYAY-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|