C10H18N2O4 — CID 108574174
prop-2-enyl N-[2-(3-methoxypropanoylamino)ethyl]carbamate (PubChem CID 108574174) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is prop-2-enyl N-[2-(3-methoxypropanoylamino)ethyl]carbamate.
| Compound Name | prop-2-enyl N-[2-(3-methoxypropanoylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 108574174 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | prop-2-enyl N-[2-(3-methoxypropanoylamino)ethyl]carbamate |
| SMILES | C=CCOC(=O)NCCNC(=O)CCOC |
| InChI | InChI=1S/C10H18N2O4/c1-3-7-16-10(14)12-6-5-11-9(13)4-8-15-2/h3H,1,4-8H2,2H3,(H,11,13)(H,12,14) |
| InChIKey | GLLFKGMGEAOPQJ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|