About methane;3-methoxy-N-(3-oxopropyl)propanamide
methane;3-methoxy-N-(3-oxopropyl)propanamide (PubChem CID 160698197) has the molecular formula C9H21NO3
and a molecular weight of 191.27 g/mol. Its IUPAC name is methane;3-methoxy-N-(3-oxopropyl)propanamide.
Molecular Properties
| Compound Name | methane;3-methoxy-N-(3-oxopropyl)propanamide |
| PubChem CID | 160698197 |
| Molecular Formula | C9H21NO3 |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.15 |
| IUPAC Name | methane;3-methoxy-N-(3-oxopropyl)propanamide |
| SMILES | C.C.COCCC(=O)NCCC=O |
| InChI | InChI=1S/C7H13NO3.2CH4/c1-11-6-3-7(10)8-4-2-5-9;;/h5H,2-4,6H2,1H3,(H,8,10);2*1H4 |
| InChIKey | RQGPDZSRJAPEST-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methane;3-methoxy-N-(3-oxopropyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-methoxy-N-(3-oxopropyl)propanamide?
The IUPAC name of methane;3-methoxy-N-(3-oxopropyl)propanamide (CID 160698197) is methane;3-methoxy-N-(3-oxopropyl)propanamide.
What is the SMILES notation for methane;3-methoxy-N-(3-oxopropyl)propanamide?
The canonical SMILES for methane;3-methoxy-N-(3-oxopropyl)propanamide is C.C.COCCC(=O)NCCC=O.
What is the InChIKey of methane;3-methoxy-N-(3-oxopropyl)propanamide?
The InChIKey is RQGPDZSRJAPEST-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3.2CH4/c1-11-6-3-7(10)8-4-2-5-9;;/h5H,2-4,6H2,1H3,(H,8,10);2*1H4.
What are the key properties of methane;3-methoxy-N-(3-oxopropyl)propanamide?
methane;3-methoxy-N-(3-oxopropyl)propanamide has a molecular weight of 191.27 g/mol, XLogP of 1.00, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-methoxy-N-(3-oxopropyl)propanamide is sourced from PubChem (CID 160698197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).