C14H27NO6 — CID 162740366
N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-oxopentanamide (PubChem CID 162740366) has the molecular formula C14H27NO6 and a molecular weight of 305.37 g/mol. Its IUPAC name is N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-oxopentanamide.
| Compound Name | N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-oxopentanamide |
|---|---|
| PubChem CID | 162740366 |
| Molecular Formula | C14H27NO6 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-oxopentanamide |
| SMILES | COCCOCCOCCOCCNC(=O)CCCC=O |
| InChI | InChI=1S/C14H27NO6/c1-18-8-9-20-12-13-21-11-10-19-7-5-15-14(17)4-2-3-6-16/h6H,2-5,7-13H2,1H3,(H,15,17) |
| InChIKey | JROXBKMYHISKRU-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|