C12H24N2O4 — CID 2933923
N,N'-bis(2-methoxyethyl)hexanediamide (PubChem CID 2933923) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is N,N'-bis(2-methoxyethyl)hexanediamide.
| Compound Name | N,N'-bis(2-methoxyethyl)hexanediamide |
|---|---|
| PubChem CID | 2933923 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | N,N'-bis(2-methoxyethyl)hexanediamide |
| SMILES | COCCNC(=O)CCCCC(=O)NCCOC |
| InChI | InChI=1S/C12H24N2O4/c1-17-9-7-13-11(15)5-3-4-6-12(16)14-8-10-18-2/h3-10H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | MQDDDWLXEYMEMN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|