C15H31NO4S — CID 71381103
N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-8-sulfanyloctanamide (PubChem CID 71381103) has the molecular formula C15H31NO4S and a molecular weight of 321.48 g/mol. Its IUPAC name is N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-8-sulfanyloctanamide.
| Compound Name | N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-8-sulfanyloctanamide |
|---|---|
| PubChem CID | 71381103 |
| Molecular Formula | C15H31NO4S |
| Molecular Weight | 321.48 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-8-sulfanyloctanamide |
| SMILES | COCCOCCOCCNC(=O)CCCCCCCS |
| InChI | InChI=1S/C15H31NO4S/c1-18-10-11-20-13-12-19-9-8-16-15(17)7-5-3-2-4-6-14-21/h21H,2-14H2,1H3,(H,16,17) |
| InChIKey | PXEGTGCTMJGZMO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|