C15H30N2O6S — CID 101361634
3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-N-[2-(3-sulfanylpropanoylamino)ethyl]propanamide (PubChem CID 101361634) has the molecular formula C15H30N2O6S and a molecular weight of 366.48 g/mol. Its IUPAC name is 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-N-[2-(3-sulfanylpropanoylamino)ethyl]propanamide.
| Compound Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-N-[2-(3-sulfanylpropanoylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 101361634 |
| Molecular Formula | C15H30N2O6S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-N-[2-(3-sulfanylpropanoylamino)ethyl]propanamide |
| SMILES | COCCOCCOCCOCCC(=O)NCCNC(=O)CCS |
| InChI | InChI=1S/C15H30N2O6S/c1-20-7-8-22-11-12-23-10-9-21-6-2-14(18)16-4-5-17-15(19)3-13-24/h24H,2-13H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | UWHIZDYVKRZICE-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|