C11H22N2O5 — CID 59805161
N-[2-[(2-methoxyacetyl)amino]ethyl]-3-(2-methoxyethoxy)propanamide (PubChem CID 59805161) has the molecular formula C11H22N2O5 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-[2-[(2-methoxyacetyl)amino]ethyl]-3-(2-methoxyethoxy)propanamide.
| Compound Name | N-[2-[(2-methoxyacetyl)amino]ethyl]-3-(2-methoxyethoxy)propanamide |
|---|---|
| PubChem CID | 59805161 |
| Molecular Formula | C11H22N2O5 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-[2-[(2-methoxyacetyl)amino]ethyl]-3-(2-methoxyethoxy)propanamide |
| SMILES | COCCOCCC(=O)NCCNC(=O)COC |
| InChI | InChI=1S/C11H22N2O5/c1-16-7-8-18-6-3-10(14)12-4-5-13-11(15)9-17-2/h3-9H2,1-2H3,(H,12,14)(H,13,15) |
| InChIKey | IAAOULQZWYPMTO-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|