C26H50N2O10 — CID 171556625
N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-3-[2-[[2-[2-[2-(3-methylpent-4-enoxy)ethoxy]ethoxy]acetyl]amino]ethoxy]propanamide (PubChem CID 171556625) has the molecular formula C26H50N2O10 and a molecular weight of 550.69 g/mol. Its IUPAC name is N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-3-[2-[[2-[2-[2-(3-methylpent-4-enoxy)ethoxy]ethoxy]acetyl]amino]ethoxy]propanamide.
| Compound Name | N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-3-[2-[[2-[2-[2-(3-methylpent-4-enoxy)ethoxy]ethoxy]acetyl]amino]ethoxy]propanamide |
|---|---|
| PubChem CID | 171556625 |
| Molecular Formula | C26H50N2O10 |
| Molecular Weight | 550.69 g/mol |
| Exact Mass | 550.35 |
| IUPAC Name | N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-3-[2-[[2-[2-[2-(3-methylpent-4-enoxy)ethoxy]ethoxy]acetyl]amino]ethoxy]propanamide |
| SMILES | C=CC(C)CCOCCOCCOCC(=O)NCCOCCC(=O)NCCOCCOCCOCCOC |
| InChI | InChI=1S/C26H50N2O10/c1-4-24(2)5-9-33-15-17-37-21-22-38-23-26(30)28-8-11-32-10-6-25(29)27-7-12-34-16-18-36-20-19-35-14-13-31-3/h4,24H,1,5-23H2,2-3H3,(H,27,29)(H,28,30) |
| InChIKey | BTEQUHGGCPBZDP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 132.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.69 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|