C17H34N2O6 — CID 169159646
ethane;3-(2-methoxyethoxy)-N-[2-[2-(3-methyl-2-oxobutoxy)ethylamino]-2-oxoethyl]propanamide (PubChem CID 169159646) has the molecular formula C17H34N2O6 and a molecular weight of 362.47 g/mol. Its IUPAC name is ethane;3-(2-methoxyethoxy)-N-[2-[2-(3-methyl-2-oxobutoxy)ethylamino]-2-oxoethyl]propanamide.
| Compound Name | ethane;3-(2-methoxyethoxy)-N-[2-[2-(3-methyl-2-oxobutoxy)ethylamino]-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 169159646 |
| Molecular Formula | C17H34N2O6 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | ethane;3-(2-methoxyethoxy)-N-[2-[2-(3-methyl-2-oxobutoxy)ethylamino]-2-oxoethyl]propanamide |
| SMILES | CC.COCCOCCC(=O)NCC(=O)NCCOCC(=O)C(C)C |
| InChI | InChI=1S/C15H28N2O6.C2H6/c1-12(2)13(18)11-23-7-5-16-15(20)10-17-14(19)4-6-22-9-8-21-3;1-2/h12H,4-11H2,1-3H3,(H,16,20)(H,17,19);1-2H3 |
| InChIKey | YIMWPHKBNUHJEF-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|