C14H27NO6V — CID 177358681
3-(2-hydroxyethoxy)-N-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]propanamide;vanadium (PubChem CID 177358681) has the molecular formula C14H27NO6V and a molecular weight of 356.32 g/mol. Its IUPAC name is 3-(2-hydroxyethoxy)-N-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]propanamide;vanadium.
| Compound Name | 3-(2-hydroxyethoxy)-N-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]propanamide;vanadium |
|---|---|
| PubChem CID | 177358681 |
| Molecular Formula | C14H27NO6V |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 3-(2-hydroxyethoxy)-N-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]propanamide;vanadium |
| SMILES | CC(C)C(=O)COCCOCCNC(=O)CCOCCO.[V] |
| InChI | InChI=1S/C14H27NO6.V/c1-12(2)13(17)11-21-10-9-20-7-4-15-14(18)3-6-19-8-5-16;/h12,16H,3-11H2,1-2H3,(H,15,18); |
| InChIKey | KEPFYIPLQKBTJC-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|