C22H43NO8 — CID 163401188
2-methyl-N-[2-[2-[2-[2-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]butanamide (PubChem CID 163401188) has the molecular formula C22H43NO8 and a molecular weight of 449.59 g/mol. Its IUPAC name is 2-methyl-N-[2-[2-[2-[2-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]butanamide.
| Compound Name | 2-methyl-N-[2-[2-[2-[2-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 163401188 |
| Molecular Formula | C22H43NO8 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | 2-methyl-N-[2-[2-[2-[2-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]butanamide |
| SMILES | CCC(C)C(=O)NCCOCCOCCOCCOCCOCCOCC(=O)C(C)C |
| InChI | InChI=1S/C22H43NO8/c1-5-20(4)22(25)23-6-7-26-8-9-27-10-11-28-12-13-29-14-15-30-16-17-31-18-21(24)19(2)3/h19-20H,5-18H2,1-4H3,(H,23,25) |
| InChIKey | HMLHZQSLURFWKK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|