C12H27NO3 — CID 171106543
3-methyl-1-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]butan-2-one;molecular hydrogen (PubChem CID 171106543) has the molecular formula C12H27NO3 and a molecular weight of 233.35 g/mol. Its IUPAC name is 3-methyl-1-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]butan-2-one;molecular hydrogen.
| Compound Name | 3-methyl-1-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]butan-2-one;molecular hydrogen |
|---|---|
| PubChem CID | 171106543 |
| Molecular Formula | C12H27NO3 |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.20 |
| IUPAC Name | 3-methyl-1-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]butan-2-one;molecular hydrogen |
| SMILES | CC(C)NCCOCCOCC(=O)C(C)C.[H][H] |
| InChI | InChI=1S/C12H25NO3.H2/c1-10(2)12(14)9-16-8-7-15-6-5-13-11(3)4;/h10-11,13H,5-9H2,1-4H3;1H |
| InChIKey | FWSGRNUXSWXLHR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|