C11H25NO3 — CID 176981069
molecular hydrogen;1-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]butan-2-one (PubChem CID 176981069) has the molecular formula C11H25NO3 and a molecular weight of 219.32 g/mol. Its IUPAC name is molecular hydrogen;1-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]butan-2-one.
| Compound Name | molecular hydrogen;1-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]butan-2-one |
|---|---|
| PubChem CID | 176981069 |
| Molecular Formula | C11H25NO3 |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | molecular hydrogen;1-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]butan-2-one |
| SMILES | CCC(=O)COCCOCCNC(C)C.[H][H] |
| InChI | InChI=1S/C11H23NO3.H2/c1-4-11(13)9-15-8-7-14-6-5-12-10(2)3;/h10,12H,4-9H2,1-3H3;1H |
| InChIKey | UGLRUPHDLXQZFP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|